Picoplatin
Modify Date: 2025-08-22 09:23:13
Picoplatin structure
|
Common Name | Picoplatin | ||
|---|---|---|---|---|
| CAS Number | 181630-15-9 | Molecular Weight | 376.147 | |
| Density | N/A | Boiling Point | 127.5ºC at 760mmHg | |
| Molecular Formula | C6H7Cl2NPt | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 26.1ºC | |
Use of PicoplatinPicoplatin (AMD473) is a platinum-based antineoplastic agent. Picoplatin is specifically to circumvent thiol-mediated drug resistance by sterically hindering its reaction with glutathione (GSH) while still retaining the ability to form cytotoxic lesions with DNA[1]. |
| Name | azane,2-methylpyridine,platinum(2+),dichloride |
|---|---|
| Synonym | More Synonyms |
| Description | Picoplatin (AMD473) is a platinum-based antineoplastic agent. Picoplatin is specifically to circumvent thiol-mediated drug resistance by sterically hindering its reaction with glutathione (GSH) while still retaining the ability to form cytotoxic lesions with DNA[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 127.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C6H7Cl2NPt |
| Molecular Weight | 376.147 |
| Flash Point | 26.1ºC |
| Exact Mass | 374.986908 |
| PSA | 12.89000 |
| LogP | 2.76650 |
| Vapour Pressure | 13.5mmHg at 25°C |
| RIDADR | UN 2811 |
|---|---|
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| Platinum(2+) chloride - 2-methylpyridine ammoniate (1:2:1:1) |
| Picoplatin |
| cis-amminedichloro(2-methylpyridine)platinum(II) |
| cis-amminedichlorido(2-methylpyridine)platinum(II) |
| cis-amminedichloro(2-picoline)platinum(II) |
| Pyridine, 2-methyl-, platinum(2+) salt, hydrochloride, ammoniate (1:1:2:1) |
| ZD 0473 |
| Picoplatin [INN:BAN] |
| (SP-4-3)-Amminedichloro(2-methylpyridine)platinium |
| AMD 473 |
| cis-PtCl2(NH3)(2-picoline) |