beta-fluoro-beta,beta,2,4,6-pentanitrophenetole structure
|
Common Name | beta-fluoro-beta,beta,2,4,6-pentanitrophenetole | ||
|---|---|---|---|---|
| CAS Number | 18138-93-7 | Molecular Weight | 365.14300 | |
| Density | 1.858g/cm3 | Boiling Point | 529.4ºC at 760mmHg | |
| Molecular Formula | C8H4FN5O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274ºC | |
| Name | 2-(2-fluoro-2,2-dinitroethoxy)-1,3,5-trinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.858g/cm3 |
|---|---|
| Boiling Point | 529.4ºC at 760mmHg |
| Molecular Formula | C8H4FN5O11 |
| Molecular Weight | 365.14300 |
| Flash Point | 274ºC |
| Exact Mass | 364.98900 |
| PSA | 238.33000 |
| LogP | 3.58270 |
| Vapour Pressure | 2.71E-11mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | UTIOXNJCGBCKFQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(OCC(F)([N+](=O)[O-])[N+](=O)[O-])c([N+](=O)[O-])c1 |
| HS Code | 2909309090 |
|---|
|
~%
beta-fluoro-bet... CAS#:18138-93-7 |
| Literature: Adolph,H.G.; Kamlet,M.J. Journal of Organic Chemistry, 1969 , vol. 34, p. 45 - 50 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| einecs 242-025-1 |