2-[benzenesulfonyl-(3-fluoro-2,4,6-trimethyl-phenyl)amino]acetic acid structure
|
Common Name | 2-[benzenesulfonyl-(3-fluoro-2,4,6-trimethyl-phenyl)amino]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 853-31-6 | Molecular Weight | 351.39300 | |
| Density | 1.345g/cm3 | Boiling Point | 540.2ºC at 760 mmHg | |
| Molecular Formula | C17H18FNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.5ºC | |
| Name | (6S)-2-(3-hydroxyphenyl)-5,6-dihydro-[1,2,4]triazolo[5,1-a]isoquinolin-6-ol |
|---|
| Density | 1.345g/cm3 |
|---|---|
| Boiling Point | 540.2ºC at 760 mmHg |
| Molecular Formula | C17H18FNO4S |
| Molecular Weight | 351.39300 |
| Flash Point | 280.5ºC |
| Exact Mass | 351.09400 |
| PSA | 83.06000 |
| LogP | 4.11160 |
| Index of Refraction | 1.597 |
| InChIKey | KVTJOZWVSGFTLG-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(N(CC(=O)O)S(=O)(=O)c2ccccc2)c(C)c1F |
|
~%
2-[benzenesulfo... CAS#:853-31-6 |
| Literature: Adams; Gortatowski Journal of the American Chemical Society, 1957 , vol. 79, p. 5525,5526,5528 |
|
~%
2-[benzenesulfo... CAS#:853-31-6 |
| Literature: Adams; Gortatowski Journal of the American Chemical Society, 1957 , vol. 79, p. 5525,5526,5528 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |