(dimethylamino)triisopropylsilane 96 structure
|
Common Name | (dimethylamino)triisopropylsilane 96 | ||
|---|---|---|---|---|
| CAS Number | 181231-66-3 | Molecular Weight | 201.42400 | |
| Density | 0.833 g/mL at 25ºC(lit.) | Boiling Point | 76-78ºC8 mm Hg(lit.) | |
| Molecular Formula | C11H27NSi | Melting Point | 27-30ºC(lit.) | |
| MSDS | N/A | Flash Point | 67ºC | |
| Name | N-methyl-N-tri(propan-2-yl)silylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.833 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 76-78ºC8 mm Hg(lit.) |
| Melting Point | 27-30ºC(lit.) |
| Molecular Formula | C11H27NSi |
| Molecular Weight | 201.42400 |
| Flash Point | 67ºC |
| Exact Mass | 201.19100 |
| PSA | 3.24000 |
| LogP | 3.72350 |
| Appearance of Characters | solid |
| Vapour Pressure | 0.0585mmHg at 25°C |
| Index of Refraction | n20/D 1.451(lit.) |
| InChIKey | RDGLSXXPVKFUJI-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)N(C)C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| WGK Germany | 3 |
| Silanamine,N,N-dimethyl-1,1,1-tris(1-methylethyl) |
| (Dimethylamino)triisopropylsilane |
| N,N-Dimethyltriisopropylsilylamine |
| MFCD00274345 |