(s)-tert-butoxycarbonylamino-indan-1-yl-acetic acid structure
|
Common Name | (s)-tert-butoxycarbonylamino-indan-1-yl-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 181227-47-4 | Molecular Weight | 291.34200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21NO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of (s)-tert-butoxycarbonylamino-indan-1-yl-acetic acidBoc-(2-indanyl)-Gly-OH is a Glycine (HY-Y0966) derivative[1]. |
| Name | (2S)-2-(2,3-dihydro-1H-inden-2-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-(2-indanyl)-Gly-OH is a Glycine (HY-Y0966) derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Molecular Formula | C16H21NO4 |
|---|---|
| Molecular Weight | 291.34200 |
| Exact Mass | 291.14700 |
| PSA | 75.63000 |
| LogP | 2.77020 |
| InChIKey | VCHHRDDQOOBPTC-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)C1Cc2ccccc2C1 |
| Storage condition | Store at 0°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (S)-2-((tert-Butoxycarbonyl)amino)-2-(2,3-dihydro-1H-inden-2-yl)acetic acid |
| (S)-N-Boc-2-indanylglycine |
| Boc-L-2-indanyglycine |
| Boc-(2-indanyl)-Gly-OH |
| AmbotzBAA1388 |