3-(2,5-DIMETHOXYPHENYL)-1H-PYRAZOLE structure
|
Common Name | 3-(2,5-DIMETHOXYPHENYL)-1H-PYRAZOLE | ||
|---|---|---|---|---|
| CAS Number | 181122-45-2 | Molecular Weight | 204.22500 | |
| Density | 1.172g/cm3 | Boiling Point | 363.784ºC at 760 mmHg | |
| Molecular Formula | C11H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.672ºC | |
| Name | 5-(2,5-dimethoxyphenyl)-1H-pyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 363.784ºC at 760 mmHg |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.22500 |
| Flash Point | 132.672ºC |
| Exact Mass | 204.09000 |
| PSA | 47.14000 |
| LogP | 2.09390 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | JEFGLUGSZPRTEJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(-c2ccn[nH]2)c1 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(2,5-DIMETHOXYPHENYL)-1H-PYRAZOLE |
| 1,4-dimethoxy-2-pyrazol-3-ylbenzene |
| MFCD02091528 |