8-chloro-2-phenylquinoline-4-carboxylic acid structure
|
Common Name | 8-chloro-2-phenylquinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 181048-56-6 | Molecular Weight | 283.70900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-chloro-2-phenylquinoline-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H10ClNO2 |
|---|---|
| Molecular Weight | 283.70900 |
| Exact Mass | 283.04000 |
| PSA | 50.19000 |
| LogP | 4.25340 |
| InChIKey | GTLIZJUNIWMBJO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccccc2)nc2c(Cl)cccc12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
|
~33%
8-chloro-2-phen... CAS#:181048-56-6 |
| Literature: Wang, Li-Min; Hu, Liang; Chen, Hong-Juan; Sui, Yuan-Yuan; Shen, Wei Journal of Fluorine Chemistry, 2009 , vol. 130, # 4 p. 406 - 409 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-Chlor-2-phenyl-chinolin-4-carbonsaeure |
| BB_SC-7378 |
| 8-chloro-2-phenyl-quinoline-4-carboxylic acid |
| 2-phenyl-8-chloroquinoline-4-carboxylic acid |