Azido-PEG3-aldehyde structure
|
Common Name | Azido-PEG3-aldehyde | ||
|---|---|---|---|---|
| CAS Number | 1807530-10-4 | Molecular Weight | 231.249 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H17N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG3-aldehydeAzido-PEG3-aldehyde is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Azido-PEG3-aldehyde |
|---|---|
| Synonym | More Synonyms |
| Description | Azido-PEG3-aldehyde is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C9H17N3O4 |
|---|---|
| Molecular Weight | 231.249 |
| Exact Mass | 231.121902 |
| LogP | -0.58 |
| InChIKey | NYVGWHGMRDHPFF-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCC=O |
| N3-PEG3-ALD |