1-Piperidineethanol,4,4'-(1,3-propanediyl)bis- structure
|
Common Name | 1-Piperidineethanol,4,4'-(1,3-propanediyl)bis- | ||
|---|---|---|---|---|
| CAS Number | 18073-84-2 | Molecular Weight | 298.46400 | |
| Density | 1.01g/cm3 | Boiling Point | 219ºC / 1mmHg | |
| Molecular Formula | C17H34N2O2 | Melting Point | 95ºC | |
| MSDS | N/A | Flash Point | 211ºC | |
| Name | 2-[4-[3-[1-(2-hydroxyethyl)piperidin-4-yl]propyl]piperidin-1-yl]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 219ºC / 1mmHg |
| Melting Point | 95ºC |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.46400 |
| Flash Point | 211ºC |
| Exact Mass | 298.26200 |
| PSA | 46.94000 |
| LogP | 1.44110 |
| Vapour Pressure | 6.42mmHg at 25°C |
| Index of Refraction | 1.4 |
| InChIKey | VSSGEWPIFHKREK-UHFFFAOYSA-N |
| SMILES | OCCN1CCC(CCCC2CCN(CCO)CC2)CC1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2933399090 |
|
~39%
1-Piperidineeth... CAS#:18073-84-2 |
| Literature: Pelaprat; Delbarre; Le Guen; Roques; Le Pecq Journal of Medicinal Chemistry, 1980 , vol. 23, # 12 p. 1336 - 1343 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 241-981-7 |