(ACETOXYETHYL)HEPTAMETHYLCYCLOTETRASILOXANE structure
|
Common Name | (ACETOXYETHYL)HEPTAMETHYLCYCLOTETRASILOXANE | ||
|---|---|---|---|---|
| CAS Number | 18048-31-2 | Molecular Weight | 368.678 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 277.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H28O6Si4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.0±23.4 °C | |
| Name | 2-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 277.3±42.0 °C at 760 mmHg |
| Molecular Formula | C11H28O6Si4 |
| Molecular Weight | 368.678 |
| Flash Point | 101.0±23.4 °C |
| Exact Mass | 368.096283 |
| PSA | 63.22000 |
| LogP | 2.80690 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.437 |
| InChIKey | YIPBVPCNPASMTO-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| HS Code | 2915390090 |
|---|
|
~%
(ACETOXYETHYL)H... CAS#:18048-31-2 |
| Literature: Goodman et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 3073,3074 |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 2-(2,4,4,6,6,8,8-Heptamethyl-1,3,5,7,2,4,6,8-tetroxatetrasilocan-2-yl)ethyl acetate |
| 1-Acetoxy-2-(heptamethyl-cyclotetrasiloxan-2-yl)-aethan |
| (2-acetoxy-ethyl)-heptamethyl-cyclotetrasiloxane |
| (2-Acetoxy-aethyl)-heptamethyl-cyclotetrasiloxan |
| 2-Cyclotetrasiloxaneethanol, 2,4,4,6,6,8,8-heptamethyl-, acetate |
| (ACETOXYETHYL)HEPTAMETHYLCYCLOTETRASILOXANE |