Methyltetrazine-PEG4-amine HCl
Modify Date: 2025-08-25 11:15:34
Methyltetrazine-PEG4-amine HCl structure
|
Common Name | Methyltetrazine-PEG4-amine HCl | ||
|---|---|---|---|---|
| CAS Number | 1802908-05-9 | Molecular Weight | 363.411 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 558.7±60.0 °C at 760 mmHg | |
| Molecular Formula | C17H25N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.7±32.9 °C | |
Use of Methyltetrazine-PEG4-amine HClMethyltetrazine-PEG4-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Methyltetrazine-PEG4-Amine |
|---|---|
| Synonym | More Synonyms |
| Description | Methyltetrazine-PEG4-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 558.7±60.0 °C at 760 mmHg |
| Molecular Formula | C17H25N5O4 |
| Molecular Weight | 363.411 |
| Flash Point | 291.7±32.9 °C |
| Exact Mass | 363.190643 |
| LogP | -0.73 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | JOEAATMYJGXMGS-UHFFFAOYSA-N |
| SMILES | Cc1nnc(-c2ccc(OCCOCCOCCOCCN)cc2)nn1 |
| 2-[2-(2-{2-[4-(6-Methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy}ethoxy)ethoxy]ethanamine |
| Ethanamine, 2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]- |
| MFCD28334553 |