4-Bromo-6,7-dimethoxyindanone structure
|
Common Name | 4-Bromo-6,7-dimethoxyindanone | ||
|---|---|---|---|---|
| CAS Number | 18028-29-0 | Molecular Weight | 271.10700 | |
| Density | 1.512g/cm3 | Boiling Point | 395.7ºC at 760mmHg | |
| Molecular Formula | C11H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.1ºC | |
| Name | 4-bromo-6,7-dimethoxy-2,3-dihydroinden-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.512g/cm3 |
|---|---|
| Boiling Point | 395.7ºC at 760mmHg |
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.10700 |
| Flash Point | 193.1ºC |
| Exact Mass | 269.98900 |
| PSA | 35.53000 |
| LogP | 2.59520 |
| Vapour Pressure | 1.8E-06mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | ACPYISCUOAQRMS-UHFFFAOYSA-N |
| SMILES | COc1cc(Br)c2c(c1OC)C(=O)CC2 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
|
~%
4-Bromo-6,7-dim... CAS#:18028-29-0 |
| Literature: Pfizer Inc. Patent: US5457237 A1, 1995 ; US 5457237 A |
|
~%
4-Bromo-6,7-dim... CAS#:18028-29-0 |
| Literature: Haworth; Koepfli; Perkin Journal of the Chemical Society, 1927 , p. 552 |
|
~%
4-Bromo-6,7-dim... CAS#:18028-29-0 |
| Literature: Haworth; Koepfli; Perkin Journal of the Chemical Society, 1927 , p. 552 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-Brom-6,7-dimethoxy-indan-1-on |
| 4-bromo-6,7-dimethoxy-2,3-dihydro-1h-inden-1-one |
| 4-Brom-6,7-dimethoxy-hydrindon |
| 4-bromo-6,7-dimethoxyindan-1-one |
| 1H-Inden-1-one,4-bromo-2,3-dihydro-6,7-dimethoxy |
| 4-bromo-6,7-dimethoxy-1-indanone |
| 4-Brom-6,7-dimethoxy-1-indanon |