1,1,1-Trichloro-2,2,2-trimethyldisilane structure
|
Common Name | 1,1,1-Trichloro-2,2,2-trimethyldisilane | ||
|---|---|---|---|---|
| CAS Number | 18026-87-4 | Molecular Weight | 207.63400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3H9Cl3Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1-Trichloro-2,2,2-trimethyldisilane |
|---|
| Molecular Formula | C3H9Cl3Si2 |
|---|---|
| Molecular Weight | 207.63400 |
| Exact Mass | 205.93100 |
| LogP | 3.05830 |
| Vapour Pressure | 9.23mmHg at 25°C |
| InChIKey | TXEDGTTUEVJNPE-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)[Si](Cl)(Cl)Cl |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |