5,8-dichloro-9,10-dihydro-9,10-dioxo-2-anthroic acid
Modify Date: 2025-08-30 20:21:07
5,8-dichloro-9,10-dihydro-9,10-dioxo-2-anthroic acid structure
|
Common Name | 5,8-dichloro-9,10-dihydro-9,10-dioxo-2-anthroic acid | ||
|---|---|---|---|---|
| CAS Number | 18018-22-9 | Molecular Weight | 321.11200 | |
| Density | 1.642g/cm3 | Boiling Point | 576.8ºC at 760mmHg | |
| Molecular Formula | C15H6Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.6ºC | |
| Name | 5,8-dichloro-9,10-dioxoanthracene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.642g/cm3 |
|---|---|
| Boiling Point | 576.8ºC at 760mmHg |
| Molecular Formula | C15H6Cl2O4 |
| Molecular Weight | 321.11200 |
| Flash Point | 302.6ºC |
| Exact Mass | 319.96400 |
| PSA | 71.44000 |
| LogP | 3.46700 |
| Vapour Pressure | 3.83E-14mmHg at 25°C |
| Index of Refraction | 1.697 |
| InChIKey | JYKRMBCKXZSUKV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)c1c(Cl)ccc(Cl)c1C2=O |
| HS Code | 2918300090 |
|---|
|
~%
5,8-dichloro-9,... CAS#:18018-22-9 |
| Literature: Eckert; Endler Journal fuer Praktische Chemie (Leipzig), 1921 , vol. <2> 102, p. 334 |
|
~%
5,8-dichloro-9,... CAS#:18018-22-9 |
| Literature: Eckert; Endler Journal fuer Praktische Chemie (Leipzig), 1921 , vol. <2> 102, p. 334 |
|
~%
Detail
|
| Literature: Eckert; Endler Journal fuer Praktische Chemie (Leipzig), 1921 , vol. <2> 102, p. 334 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 5,8-Dichlor-9,10-dioxo-9,10-dihydro-anthracen-2-carbonsaeure |
| EINECS 241-928-8 |
| 5,8-dichloro-9,10-dioxo-9,10-dihydro-anthracene-2-carboxylic acid |
| 5,8-Dichloro-9,10-dihydro-9,10-dioxo-2-anthroic acid |