decafluoro-5-(trifluoromethyl)hexanoyl fluoride
Modify Date: 2025-09-21 11:34:13
decafluoro-5-(trifluoromethyl)hexanoyl fluoride structure
|
Common Name | decafluoro-5-(trifluoromethyl)hexanoyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 18017-31-7 | Molecular Weight | 366.05200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7F14O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | decafluoro-5-(trifluoromethyl)hexanoyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7F14O |
|---|---|
| Molecular Weight | 366.05200 |
| Exact Mass | 365.97300 |
| PSA | 17.07000 |
| LogP | 4.22130 |
| Vapour Pressure | 52.5mmHg at 25°C |
| InChIKey | JQXGQDNUXYODIT-UHFFFAOYSA-N |
| SMILES | O=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| hexanoyl fluoride, 2,2,3,3,4,4,5,6,6,6-decafluoro-5-(trifluoromethyl)- |