2,2,3,3,4,4,5,6,6,6-decafluoro-5-(trifluoromethyl)hexanoic acid, compound with ethylamine (1:1) structure
|
Common Name | 2,2,3,3,4,4,5,6,6,6-decafluoro-5-(trifluoromethyl)hexanoic acid, compound with ethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 68015-84-9 | Molecular Weight | 409.145 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8F13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,3,3,4,4,5,6,6,6-Decafluoro-5-(trifluoromethyl)hexanoic acid-ethanamine (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H8F13NO2 |
|---|---|
| Molecular Weight | 409.145 |
| Exact Mass | 409.034760 |
| InChIKey | YSXXTTJIKUEKFH-UHFFFAOYSA-N |
| SMILES | CCN.O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| Hexanoic acid, 2,2,3,3,4,4,5,6,6,6-decafluoro-5-(trifluoromethyl)-, compd. with ethanamine (1:1) |
| EINECS 268-149-6 |
| 2,2,3,3,4,4,5,6,6,6-Decafluoro-5-(trifluoromethyl)hexanoic acid - ethanamine (1:1) |