Trichloro(1-naphthylmethyl)silane
Modify Date: 2025-08-26 02:02:39
Trichloro(1-naphthylmethyl)silane structure
|
Common Name | Trichloro(1-naphthylmethyl)silane | ||
|---|---|---|---|---|
| CAS Number | 17998-59-3 | Molecular Weight | 275.634 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 290.5±9.0 °C at 760 mmHg | |
| Molecular Formula | C11H9Cl3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.9±13.4 °C | |
| Name | trichloro(naphthalen-1-ylmethyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 290.5±9.0 °C at 760 mmHg |
| Molecular Formula | C11H9Cl3Si |
| Molecular Weight | 275.634 |
| Flash Point | 141.9±13.4 °C |
| Exact Mass | 273.953918 |
| LogP | 7.20 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | ZTCCIXDZFGSHTQ-UHFFFAOYSA-N |
| SMILES | Cl[Si](Cl)(Cl)Cc1cccc2ccccc12 |
|
~%
Trichloro(1-nap... CAS#:17998-59-3 |
| Literature: Chernyshev,E.A. et al. J. Gen. Chem. USSR (Engl. Transl.), 1976 , vol. 46, p. 1286 - 1290,1267 - 1270 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Silane,trichloro(1-naphthalenylmethyl) |
| Naphthalene,1-[(trichlorosilyl)methyl] |
| Silane,trichloro(1-naphthylmethyl)-(6CI,8CI) |
| Trichlor-<naphthyl-(1)-methyl>-silan |
| Silane,trichloro(1-naphthalenylmethyl)-(9CI) |
| Naphthalene, 1-[(trichlorosilyl)methyl]- |
| Trichloro-1-naphthylmethylsilane |
| (NAPHTHALEN-1-YLMETHYL)TRICHLOROSILANE |
| Trichlor-<(1-naphthyl)-methyl>-silan |
| Trichloro(1-naphthylmethyl)silane |
| Trichlor-<(1-naphthyl)-methyl>lsilan |