Sempervirine nitrate structure
|
Common Name | Sempervirine nitrate | ||
|---|---|---|---|---|
| CAS Number | 17994-15-9 | Molecular Weight | 335.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sempervirine nitrateSempervirine is an alkaloid derived from Gelsemium elegans Benth.. Sempervirine inhibits the proliferation of hepatocellular carcinoma (HCC) cells and induces apoptosis by regulating Wnt/β-catenin pathway[1]. |
| Name | 16,17,18,19-tetrahydro-3H-yohimban-13-ium,nitrate |
|---|
| Description | Sempervirine is an alkaloid derived from Gelsemium elegans Benth.. Sempervirine inhibits the proliferation of hepatocellular carcinoma (HCC) cells and induces apoptosis by regulating Wnt/β-catenin pathway[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H17N3O3 |
|---|---|
| Molecular Weight | 335.36 |
| Exact Mass | 337.14300 |
| PSA | 80.43000 |
| LogP | 3.48230 |
| InChIKey | NPMOCMWCFIQGMK-UHFFFAOYSA-O |
| SMILES | O=[N+]([O-])[O-].c1ccc2c(c1)[nH]c1c2cc[n+]2cc3c(cc12)CCCC3 |