2-chloro-N-(2-hydroxy-5-methylphenyl)propanamide structure
|
Common Name | 2-chloro-N-(2-hydroxy-5-methylphenyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 17959-87-4 | Molecular Weight | 213.66100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-N-(2-hydroxy-5-methylphenyl)propanamide |
|---|
| Molecular Formula | C10H12ClNO2 |
|---|---|
| Molecular Weight | 213.66100 |
| Exact Mass | 213.05600 |
| PSA | 52.82000 |
| LogP | 2.91590 |
| InChIKey | UPOIUUHEKQDPCN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O)c(NC(=O)C(C)Cl)c1 |
|
~%
2-chloro-N-(2-h... CAS#:17959-87-4 |
| Literature: Drain; Daly; Davy; Horlington; Howes; Scruton; Selway The Journal of pharmacy and pharmacology, 1970 , vol. 22, # 9 p. 684 - 693 |