Iopamidol-d8 structure
|
Common Name | Iopamidol-d8 | ||
|---|---|---|---|---|
| CAS Number | 1795778-90-3 | Molecular Weight | 785.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14D8I3N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Iopamidol-d8Iopamidol-d8 (B-15000-d8) is the deuterium labeled Iopamidol. Iopamidol is a nonionic, X-Ray iodinated contrast agent (CA) for a wide variety of diagnostic applications. Iopamidol contains amide and hydroxyl functionalities that can be exploited for the generation of the chemical exchange saturation transfer (CEST) contrast[1]. |
| Name | Iopamidol-d8 |
|---|
| Description | Iopamidol-d8 (B-15000-d8) is the deuterium labeled Iopamidol. Iopamidol is a nonionic, X-Ray iodinated contrast agent (CA) for a wide variety of diagnostic applications. Iopamidol contains amide and hydroxyl functionalities that can be exploited for the generation of the chemical exchange saturation transfer (CEST) contrast[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C17H14D8I3N3O8 |
|---|---|
| Molecular Weight | 785.13 |
| InChIKey | XQZXYNRDCRIARQ-ZESHZVJFSA-N |
| SMILES | CC(O)C(=O)Nc1c(I)c(C(=O)NC(CO)CO)c(I)c(C(=O)NC(CO)CO)c1I |