N-(5-Iodo-4-methyl-pyridin-2-yl)-2,2-dimethyl-propionamide
Modify Date: 2025-08-27 08:19:31
N-(5-Iodo-4-methyl-pyridin-2-yl)-2,2-dimethyl-propionamide structure
|
Common Name | N-(5-Iodo-4-methyl-pyridin-2-yl)-2,2-dimethyl-propionamide | ||
|---|---|---|---|---|
| CAS Number | 179554-56-4 | Molecular Weight | 318.15400 | |
| Density | 1.562g/cm3 | Boiling Point | 413.2ºC at 760mmHg | |
| Molecular Formula | C11H15IN2O | Melting Point | 113.5-113-7ºC | |
| MSDS | USA | Flash Point | 203.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-(5-Iodo-4-methyl-pyridin-2-yl)-2,2-dimethyl-propionamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.562g/cm3 |
|---|---|
| Boiling Point | 413.2ºC at 760mmHg |
| Melting Point | 113.5-113-7ºC |
| Molecular Formula | C11H15IN2O |
| Molecular Weight | 318.15400 |
| Flash Point | 203.7ºC |
| Exact Mass | 318.02300 |
| PSA | 41.99000 |
| LogP | 3.05220 |
| Vapour Pressure | 4.9E-07mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | UXKKWMDNOQJJSM-UHFFFAOYSA-N |
| SMILES | Cc1cc(NC(=O)C(C)(C)C)ncc1I |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(5-iodo-4-methylpyridin-2-yl)-2,2-dimethylpropanamide |