Piromidic Acid-d5 structure
|
Common Name | Piromidic Acid-d5 | ||
|---|---|---|---|---|
| CAS Number | 1794759-27-5 | Molecular Weight | 293.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11D5N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Piromidic Acid-d5Piromidic Acid-d5 is the deuterium labeled Piromidic acid. Piromidic acid is an antibacterial agent. Piromidic acid is active against gramnegative bacteria and staphylococci and can be used for the research of intestinal, urinary, and biliary tract infections[1][2]. |
| Name | Piromidic Acid-d5 |
|---|
| Description | Piromidic Acid-d5 is the deuterium labeled Piromidic acid. Piromidic acid is an antibacterial agent. Piromidic acid is active against gramnegative bacteria and staphylococci and can be used for the research of intestinal, urinary, and biliary tract infections[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C14H11D5N4O3 |
|---|---|
| Molecular Weight | 293.33 |
| InChIKey | JPKVGKXYVOPKKM-ZBJDZAJPSA-N |
| SMILES | CCn1cc(C(=O)O)c(=O)c2ncc(N3CCCC3)nc21 |