9,10,12,13-tetrabromostearic acid
Modify Date: 2025-08-25 16:09:24
9,10,12,13-tetrabromostearic acid structure
|
Common Name | 9,10,12,13-tetrabromostearic acid | ||
|---|---|---|---|---|
| CAS Number | 1794-89-4 | Molecular Weight | 600.06100 | |
| Density | 1.602g/cm3 | Boiling Point | 565.8ºC at 760mmHg | |
| Molecular Formula | C18H32Br4O2 | Melting Point | 115ºC | |
| MSDS | N/A | Flash Point | 296ºC | |
| Name | 9,10,12,13-tetrabromooctadecanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.602g/cm3 |
|---|---|
| Boiling Point | 565.8ºC at 760mmHg |
| Melting Point | 115ºC |
| Molecular Formula | C18H32Br4O2 |
| Molecular Weight | 600.06100 |
| Flash Point | 296ºC |
| Exact Mass | 595.91400 |
| PSA | 37.30000 |
| LogP | 7.82610 |
| Vapour Pressure | 2.77E-14mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | HTORNZPNCYXGMR-UHFFFAOYSA-N |
| SMILES | CCCCCC(Br)C(Br)CC(Br)C(Br)CCCCCCCC(=O)O |
| HS Code | 2915900090 |
|---|
|
~82%
9,10,12,13-tetr... CAS#:1794-89-4 |
| Literature: Rodriguez-Saona, Cesar; Millar, Jocelyn G.; Maynard, David F.; Trumble, John T. Journal of Chemical Ecology, 1998 , vol. 24, # 5 p. 867 - 889 |
|
~%
9,10,12,13-tetr... CAS#:1794-89-4 |
| Literature: Journal of the American Chemical Society, , vol. 62, p. 1797 |
|
~%
9,10,12,13-tetr... CAS#:1794-89-4 |
| Literature: Journal of the American Chemical Society, , vol. 62, p. 1797 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
CAS#:544-35-4| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Tetrabrom-stearinsaeure |
| 9,10,12,13-Tetrabromooctadecanoic Acid |
| 9,10,12,13-tetrabromo-octadecanoic acid |
| 9,10,12,13-Tetrabrom-octadecansaeure |
| 9,10,12,13-Tetrabromostearic Acid |
| EINECS 217-266-0 |
| 9,10,12,13-Tetrabromstearinsaeure |
| 9,10,12,13-Tetrabromostearic acid |