4-Methyl-7-nitroindoline structure
|
Common Name | 4-Methyl-7-nitroindoline | ||
|---|---|---|---|---|
| CAS Number | 179176-31-9 | Molecular Weight | 178.188 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 332.2±41.0 °C at 760 mmHg | |
| Molecular Formula | C9H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.7±27.6 °C | |
| Name | 4-methyl-7-nitro-2,3-dihydro-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 332.2±41.0 °C at 760 mmHg |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.188 |
| Flash Point | 154.7±27.6 °C |
| Exact Mass | 178.074234 |
| PSA | 57.85000 |
| LogP | 2.67 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | SCFZFJRSCMUKHY-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])c2c1CCN2 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole, 2,3-dihydro-4-methyl-7-nitro- |
| 4-Methyl-7-nitroindoline |