GL67 structure
|
Common Name | GL67 | ||
|---|---|---|---|---|
| CAS Number | 179075-30-0 | Molecular Weight | 614.99 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H70N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GL67GL67 (N4-Spermine cholesteryl carbamate) is a cationic lipid. GL67 can be used for nucleic acid drugs and vaccines delivery, and gene transfection[1]. |
| Name | GL67 |
|---|
| Description | GL67 (N4-Spermine cholesteryl carbamate) is a cationic lipid. GL67 can be used for nucleic acid drugs and vaccines delivery, and gene transfection[1]. |
|---|---|
| Related Catalog |
| Molecular Formula | C38H70N4O2 |
|---|---|
| Molecular Weight | 614.99 |
| InChIKey | KBBLYWGVXTZWCU-HMVYLTCSSA-N |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)N(CCCN)CCCCNCCCN)CCC4(C)C3CCC12C |