5-Methoxy-2-nitro-4-(trifluoroMethyl)phenylacetonitrile structure
|
Common Name | 5-Methoxy-2-nitro-4-(trifluoroMethyl)phenylacetonitrile | ||
|---|---|---|---|---|
| CAS Number | 178896-77-0 | Molecular Weight | 260.16900 | |
| Density | 1.243g/cm3 | Boiling Point | 321.4ºC at 760 mmHg | |
| Molecular Formula | C10H7F3N2O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 148.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(4-(trifluoromethyl)-2,5-dimethoxyphenyl)acetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 321.4ºC at 760 mmHg |
| Molecular Formula | C10H7F3N2O3 |
| Molecular Weight | 260.16900 |
| Flash Point | 148.2ºC |
| Exact Mass | 260.04100 |
| PSA | 78.84000 |
| LogP | 3.21148 |
| Vapour Pressure | 0.000299mmHg at 25°C |
| Index of Refraction | 1.46 |
| InChIKey | IANAREFPKLOIAF-UHFFFAOYSA-N |
| SMILES | COc1cc(CC#N)c([N+](=O)[O-])cc1C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2926909090 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| [5-Methoxy-2-nitro-4-(trifluoromethyl)phenyl]acetonitrile |
| (5-Methoxy-2-nitro-4-trifluoromethyl-phenyl)-acetonitrile |