N2-(5-Fluoro-2,4-dinitrophenyl)-L-leucinamide structure
|
Common Name | N2-(5-Fluoro-2,4-dinitrophenyl)-L-leucinamide | ||
|---|---|---|---|---|
| CAS Number | 178065-29-7 | Molecular Weight | 314.270 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 541.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C12H15FN4O5 | Melting Point | 170ºC | |
| MSDS | N/A | Flash Point | 281.3±30.1 °C | |
| Name | (2S)-2-(5-fluoro-2,4-dinitroanilino)-4-methylpentanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 541.6±50.0 °C at 760 mmHg |
| Melting Point | 170ºC |
| Molecular Formula | C12H15FN4O5 |
| Molecular Weight | 314.270 |
| Flash Point | 281.3±30.1 °C |
| Exact Mass | 314.102661 |
| PSA | 147.75000 |
| LogP | 3.27 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | WCOZOJGXDVGGIK-VIFPVBQESA-N |
| SMILES | CC(C)CC(Nc1cc(F)c([N+](=O)[O-])cc1[N+](=O)[O-])C(N)=O |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Pentanamide, 2-[(5-fluoro-2,4-dinitrophenyl)amino]-4-methyl-, (2S)- |
| N-(5-Fluoro-2,4-dinitrophenyl)-L-leucinamide |
| Nα-(5-Fluoro-2,4-dinitrophenyl)-L-leucinamide |
| MFCD03844761 |