4,4''-Dibromo-1,1':4',1''-terphenyl structure
|
Common Name | 4,4''-Dibromo-1,1':4',1''-terphenyl | ||
|---|---|---|---|---|
| CAS Number | 17788-94-2 | Molecular Weight | 388.096 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 481.7±25.0 °C at 760 mmHg | |
| Molecular Formula | C18H12Br2 | Melting Point | 315ºC | |
| MSDS | Chinese USA | Flash Point | 285.5±22.4 °C | |
| Symbol |
GHS05, GHS07, GHS09 |
Signal Word | Danger | |
| Name | 4,4''-Dibromo-p-terphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 481.7±25.0 °C at 760 mmHg |
| Melting Point | 315ºC |
| Molecular Formula | C18H12Br2 |
| Molecular Weight | 388.096 |
| Flash Point | 285.5±22.4 °C |
| Exact Mass | 385.930573 |
| LogP | 7.44 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | VAIPJQIPFPRJKJ-UHFFFAOYSA-N |
| SMILES | Brc1ccc(-c2ccc(-c3ccc(Br)cc3)cc2)cc1 |
| Symbol |
GHS05, GHS07, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H318-H335-H410 |
| Precautionary Statements | P261-P273-P280-P305 + P351 + P338-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| RIDADR | UN 3152PSN2 9 / PGII |
| HS Code | 2903999090 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4,4''-Dibrom-p-terphenyl |
| 4,4''-dibromoterphenyl |
| 4,4''-Dibromo-1,1':4',1''-terphenyl |
| 4,4''-DibroMo-p-terphenyl |
| 1,1':4',1''-Terphenyl, 4,4''-dibromo- |
| 4,4'-dibromo-p-terphenyl |