Peptide R structure
|
Common Name | Peptide R | ||
|---|---|---|---|---|
| CAS Number | 1774344-28-3 | Molecular Weight | 902.10 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H59N13O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Peptide RPeptide R, a cyclic peptide, is a specific CXCR4 antagonist. Peptide R shows outstanding capacities to profoundly remodel the tumor stroma. Peptide R has the potential for tumor research[1][2]. |
| Name | Peptide R |
|---|
| Description | Peptide R, a cyclic peptide, is a specific CXCR4 antagonist. Peptide R shows outstanding capacities to profoundly remodel the tumor stroma. Peptide R has the potential for tumor research[1][2]. |
|---|---|
| Related Catalog | |
| Target |
CXCR4 |
| References |
| Molecular Formula | C39H59N13O8S2 |
|---|---|
| Molecular Weight | 902.10 |
| InChIKey | QUGHRLVSZPPQPK-ODKJCKIQSA-N |
| SMILES | CC(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(CS)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(CS)C(=O)O |