2,4(1H,3H)-Quinazolinedione, 6-hydroxy-3-methyl- structure
|
Common Name | 2,4(1H,3H)-Quinazolinedione, 6-hydroxy-3-methyl- | ||
|---|---|---|---|---|
| CAS Number | 17730-75-5 | Molecular Weight | 192.17100 | |
| Density | 1.425g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-hydroxy-3-methyl-1H-quinazoline-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.425g/cm3 |
|---|---|
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17100 |
| Exact Mass | 192.05300 |
| PSA | 75.35000 |
| LogP | 0.34470 |
| Index of Refraction | 1.623 |
| InChIKey | IWIXKFMAKCFCLR-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)[nH]c2ccc(O)cc2c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Methyl-6-hydroxyquinazoline-2,4-dione |