2,4(1H,3H)-Quinazolinedione,6-chloro-3-methyl- structure
|
Common Name | 2,4(1H,3H)-Quinazolinedione,6-chloro-3-methyl- | ||
|---|---|---|---|---|
| CAS Number | 15949-47-0 | Molecular Weight | 210.61700 | |
| Density | 1.42g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-chloro-3-methyl-1H-quinazoline-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Molecular Formula | C9H7ClN2O2 |
| Molecular Weight | 210.61700 |
| Exact Mass | 210.02000 |
| PSA | 54.86000 |
| LogP | 0.88020 |
| Index of Refraction | 1.597 |
| InChIKey | PGIWQURLFCAYHA-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)[nH]c2ccc(Cl)cc2c1=O |
|
~81%
2,4(1H,3H)-Quin... CAS#:15949-47-0 |
| Literature: Lezina; Rubtsova; Polukeev; Kutchin Russian Journal of Organic Chemistry, 2012 , vol. 48, # 9 p. 1222 - 1225 Zh. Org. Khim., 2012 , vol. 48, # 9 p. 1223 - 1226,4 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-methyl-6-chloro-2,4-dioxo-1,2,3,4-tetrahydro-quinazoline |
| 2,4-Dioxo-6-chlor-3-methyl-1,2,3,4-tetrahydro-chinazolin |