2-[2-(trifluoromethoxy)phenyl]aniline
Modify Date: 2025-08-25 14:08:36
![2-[2-(trifluoromethoxy)phenyl]aniline Structure](https://image.chemsrc.com/caspic/136/175676-54-7.png)
2-[2-(trifluoromethoxy)phenyl]aniline structure
|
Common Name | 2-[2-(trifluoromethoxy)phenyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 175676-54-7 | Molecular Weight | 253.22000 | |
| Density | 1.282g/cm3 | Boiling Point | 124-128ºC 8mm | |
| Molecular Formula | C13H10F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.8ºC | |
| Name | 2-[2-(trifluoromethoxy)phenyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.282g/cm3 |
|---|---|
| Boiling Point | 124-128ºC 8mm |
| Molecular Formula | C13H10F3NO |
| Molecular Weight | 253.22000 |
| Flash Point | 120.8ºC |
| Exact Mass | 253.07100 |
| PSA | 35.25000 |
| LogP | 4.41560 |
| Vapour Pressure | 0.00489mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | AYVFXUXDUIPECW-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1-c1ccccc1OC(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922199090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:577-19-5
CAS#:175278-00-9| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| pc4222 |