ETHYL (5-FLUORO-2-METHYL-1H-INDOL-3-YL)ACETATE
ETHYL (5-FLUORO-2-METHYL-1H-INDOL-3-YL)ACETATE structure
|
Common Name | ETHYL (5-FLUORO-2-METHYL-1H-INDOL-3-YL)ACETATE | ||
|---|---|---|---|---|
| CAS Number | 17536-39-9 | Molecular Weight | 235.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H14FNO2 |
|---|---|
| Molecular Weight | 235.25400 |
| Exact Mass | 235.10100 |
| PSA | 42.09000 |
| LogP | 2.72100 |
| InChIKey | QJOJSMQJAHIRLS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1c(C)[nH]c2ccc(F)cc12 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 1 | |
CAS#:823-85-8
CAS#:123-76-2
CAS#:539-88-8
CAS#:371-14-2
CAS#:64-17-5
CAS#:71987-67-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (5-fluoro-2-methyl-1H-indol-3-yl)acetic acid ethyl ester |
| ethyl (5-Fluoro-2-methylindol-3-yl)acetate |
| (5-fluoro-2-methyl-indol-3-yl)-acetic acid ethyl ester |
| 5-fluoro-2-methyl-1H-indole-3-acetic acid ethyl ester |
| ethyl-5-fluoro-2-methyl-3-indoleacetate |
| 2-Methyl-5-fluor-3-indolylessigsaeureethylester |
| 1H-Indole-3-acetic acid,5-fluoro-2-methyl-,ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate? |
| A: Polar surface area (PSA) of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate is 42.09000. |
| Q: What is the LogP of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate? |
| A: LogP of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate is 2.72100. |
| Q: What is the CAS number of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate? |
| A: CAS number of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate is 17536-39-9. |
| Q: What is the molecular formula of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate? |
| A: Molecular formula of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate is C13H14FNO2. |
| Q: What are the upstream materials of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate? |
| A: Related upstream materials(CAS) of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate: 823-85-8;123-76-2;539-88-8;371-14-2;64-17-5. |
| Q: What English synonyms does ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate have? |
| A: English synonyms of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate: (5-fluoro-2-methyl-1H-indol-3-yl)acetic acid ethyl ester, ethyl (5-Fluoro-2-methylindol-3-yl)acetate, (5-fluoro-2-methyl-indol-3-yl)-acetic acid ethyl ester, 5-fluoro-2-methyl-1H-indole-3-acetic acid ethyl ester, ethyl-5-fluoro-2-methyl-3-indoleacetate, 2-Methyl-5-fluor-3-indolylessigsaeureethylester, 1H-Indole-3-acetic acid,5-fluoro-2-methyl-,ethyl ester. |
| Q: What is the InChIKey of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate? |
| A: InChIKey of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate is QJOJSMQJAHIRLS-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate? |
| A: SMILES notation of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate is CCOC(=O)Cc1c(C)[nH]c2ccc(F)cc12. |
| Q: What is the molecular weight of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate? |
| A: Molecular weight of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate is 235.25400. |
| Q: What is the English name of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate? |
| A: The English name of ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate is ethyl 2-(5-fluoro-2-methyl-1H-indol-3-yl)acetate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |