3-amino-4-hydroxy-5-nitrobenzenesulfonic acid,hydrate
Modify Date: 2025-08-25 12:43:00
3-amino-4-hydroxy-5-nitrobenzenesulfonic acid,hydrate structure
|
Common Name | 3-amino-4-hydroxy-5-nitrobenzenesulfonic acid,hydrate | ||
|---|---|---|---|---|
| CAS Number | 175278-60-1 | Molecular Weight | 252.20200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H8N2O7S | Melting Point | 299-301ºC (dec.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-amino-4-hydroxy-5-nitrobenzenesulfonic acid,hydrate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 299-301ºC (dec.) |
|---|---|
| Molecular Formula | C6H8N2O7S |
| Molecular Weight | 252.20200 |
| Exact Mass | 252.00500 |
| PSA | 164.05000 |
| LogP | 2.25020 |
| Vapour Pressure | 5.48E-15mmHg at 25°C |
| InChIKey | HJASIPICABEOAV-UHFFFAOYSA-N |
| SMILES | Nc1cc(S(=O)(=O)O)cc([N+](=O)[O-])c1O.O |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-amino-4-hydroxy-5-nitrobenzenesulfonic acid hydrate |