2-Chloro-4-(trifluoromethyl)benzene-1-sulfonylchloride structure
|
Common Name | 2-Chloro-4-(trifluoromethyl)benzene-1-sulfonylchloride | ||
|---|---|---|---|---|
| CAS Number | 175205-54-6 | Molecular Weight | 279.06400 | |
| Density | 1.597 g/mL at 25 °C(lit.) | Boiling Point | 70-71 °C0.5 mm Hg(lit.) | |
| Molecular Formula | C7H3Cl2F3O2S | Melting Point | 37-39°C | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2-chloro-4-(trifluoromethyl)benzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.597 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 70-71 °C0.5 mm Hg(lit.) |
| Melting Point | 37-39°C |
| Molecular Formula | C7H3Cl2F3O2S |
| Molecular Weight | 279.06400 |
| Flash Point | >230 °F |
| Exact Mass | 277.91800 |
| PSA | 42.52000 |
| LogP | 4.36710 |
| Vapour Pressure | 0.00819mmHg at 25°C |
| Index of Refraction | n20/D 1.5080(lit.) |
| InChIKey | NJXDBSSSDPOAFI-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(C(F)(F)F)cc1Cl |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314-H317 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-chloro-4-trifluoromethylbenzenesulphonyl chloride |
| 2-chloro-4-trifluoromethylphenylsulfonyl chloride |
| 2-Chloro-4-(trifluoroMethyl)benzenesulfonyl Chloride |
| 2-Chloro-4-(trifluoromethyl)benzene-1-sulfonyl chloride |
| MFCD00052912 |