2-tert-butyl-7-chloro-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine structure
|
Common Name | 2-tert-butyl-7-chloro-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 175203-38-0 | Molecular Weight | 277.67300 | |
| Density | 1.574g/cm3 | Boiling Point | 389.4ºC at 760 mmHg | |
| Molecular Formula | C11H11ClF3N3 | Melting Point | 70-73ºC | |
| MSDS | N/A | Flash Point | 189.3ºC | |
| Name | 2-tert-butyl-7-chloro-5-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.574g/cm3 |
|---|---|
| Boiling Point | 389.4ºC at 760 mmHg |
| Melting Point | 70-73ºC |
| Molecular Formula | C11H11ClF3N3 |
| Molecular Weight | 277.67300 |
| Flash Point | 189.3ºC |
| Exact Mass | 277.05900 |
| PSA | 30.19000 |
| LogP | 3.69900 |
| Vapour Pressure | 1.27E-06mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | VYAQQNNHHQAUEL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc2nc(C(F)(F)F)cc(Cl)n2n1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| pc1604 |
| MFCD00178914 |