methylcapsaicin structure
|
Common Name | methylcapsaicin | ||
|---|---|---|---|---|
| CAS Number | 17514-11-3 | Molecular Weight | 319.43800 | |
| Density | 1.03g/cm3 | Boiling Point | 515.9ºC at 760mmHg | |
| Molecular Formula | C19H29NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.8ºC | |
Use of methylcapsaicinTRPV1 activator-2 (compound 9), a capsaicin head analog, makes specific interactions with channel residues at the lipid-water[1]. |
| Name | (E)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-2,8-dimethylnon-6-enamide |
|---|---|
| Synonym | More Synonyms |
| Description | TRPV1 activator-2 (compound 9), a capsaicin head analog, makes specific interactions with channel residues at the lipid-water[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 515.9ºC at 760mmHg |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.43800 |
| Flash Point | 265.8ºC |
| Exact Mass | 319.21500 |
| PSA | 58.56000 |
| LogP | 4.42650 |
| Vapour Pressure | 2.91E-11mmHg at 25°C |
| Index of Refraction | 1.52 |
| InChIKey | AWRGGJPZAHOHGI-SOFGYWHQSA-N |
| SMILES | COc1cc(CNC(=O)C(C)CCCC=CC(C)C)ccc1O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Methylcapsaicin |
| markiertes Capsaicin |
| O-Methyl-capsaicin |