ethyl 1-(2,4-difluorophenyl)-5-methylpyrazole-4-carboxylate
Modify Date: 2025-08-23 10:10:28
ethyl 1-(2,4-difluorophenyl)-5-methylpyrazole-4-carboxylate structure
|
Common Name | ethyl 1-(2,4-difluorophenyl)-5-methylpyrazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 175135-71-4 | Molecular Weight | 266.24300 | |
| Density | 1.56g/cm3 | Boiling Point | 410.9ºC at 760mmHg | |
| Molecular Formula | C13H12F2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.3ºC | |
| Name | ethyl 1-(2,4-difluorophenyl)-5-methylpyrazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 410.9ºC at 760mmHg |
| Molecular Formula | C13H12F2N2O2 |
| Molecular Weight | 266.24300 |
| Flash Point | 202.3ºC |
| Exact Mass | 266.08700 |
| PSA | 44.12000 |
| LogP | 2.63560 |
| Vapour Pressure | 5.82E-07mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | WVZDFYXWWMSKSH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnn(-c2ccc(F)cc2F)c1C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Safety Phrases | S23-S24/25 |
| HS Code | 2933199090 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms546l02 |
| pc3211 |