2-(2,4-difluorophenoxy)-3-nitropyridine structure
|
Common Name | 2-(2,4-difluorophenoxy)-3-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 175135-62-3 | Molecular Weight | 252.17400 | |
| Density | 1.355g/cm3 | Boiling Point | 301.2ºC at 760mmHg | |
| Molecular Formula | C11H6F2N2O3 | Melting Point | 63ºC | |
| MSDS | N/A | Flash Point | 136ºC | |
| Name | 2-(2,4-difluorophenoxy)-3-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.355g/cm3 |
|---|---|
| Boiling Point | 301.2ºC at 760mmHg |
| Melting Point | 63ºC |
| Molecular Formula | C11H6F2N2O3 |
| Molecular Weight | 252.17400 |
| Flash Point | 136ºC |
| Exact Mass | 252.03500 |
| PSA | 67.94000 |
| LogP | 3.58350 |
| Vapour Pressure | 0.00107mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | WZRAMZMIQUBNMG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccnc1Oc1ccc(F)cc1F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-dimethoxy-3,7-bis(methylseleno)-naphthalene |
| hms546c22 |
| MFCD00067800 |