bacteriopheophytin structure
|
Common Name | bacteriopheophytin | ||
|---|---|---|---|---|
| CAS Number | 17453-58-6 | Molecular Weight | 889.21500 | |
| Density | 1.095g/cm3 | Boiling Point | 997.8ºC at 760mmHg | |
| Molecular Formula | C55H76N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 557.2ºC | |
Use of bacteriopheophytinBacteriopheophytin, a photosynthetic pigment, is a bacterial demagnetised chlorophyll composed of bacterial chlorophyll in which two hydrogen atoms replace the magnesium center. Bacteriopheophytin acts as an electron acceptor in the purple bacterial reaction center (RC) and is involved in electron transfer[1]. |
| Name | bacteriopheophytin a |
|---|---|
| Synonym | More Synonyms |
| Description | Bacteriopheophytin, a photosynthetic pigment, is a bacterial demagnetised chlorophyll composed of bacterial chlorophyll in which two hydrogen atoms replace the magnesium center. Bacteriopheophytin acts as an electron acceptor in the purple bacterial reaction center (RC) and is involved in electron transfer[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.095g/cm3 |
|---|---|
| Boiling Point | 997.8ºC at 760mmHg |
| Molecular Formula | C55H76N4O6 |
| Molecular Weight | 889.21500 |
| Flash Point | 557.2ºC |
| Exact Mass | 888.57600 |
| PSA | 143.04000 |
| LogP | 9.87830 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | KWOZSBGNAHVCKG-WFDCHTCOSA-N |
| SMILES | CCC1c2cc3[nH]c4c(c3C)C(=O)C(C(=O)OC)c4c3nc(cc4[nH]c(cc(n2)C1C)c(C(C)=O)c4C)C(C)C3CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C |
| Bacteriophaeophytin-a |
| Bacteriopheophytin |
| bacteriochlorophyll a |
| bacteriopheophorbide a phytyl |
| BPB |