5-(Trifluoromethyl)-2-pyridinesulfonyl chloride
Modify Date: 2025-08-21 15:37:25
5-(Trifluoromethyl)-2-pyridinesulfonyl chloride structure
|
Common Name | 5-(Trifluoromethyl)-2-pyridinesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 174485-72-4 | Molecular Weight | 245.607 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 277.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C6H3ClF3NO2S | Melting Point | 50-52ºC | |
| MSDS | N/A | Flash Point | 121.7±27.3 °C | |
| Name | 5-(trifluoromethyl)pyridine-2-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 277.7±40.0 °C at 760 mmHg |
| Melting Point | 50-52ºC |
| Molecular Formula | C6H3ClF3NO2S |
| Molecular Weight | 245.607 |
| Flash Point | 121.7±27.3 °C |
| Exact Mass | 244.952515 |
| PSA | 55.41000 |
| LogP | 2.28 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | MRIFFPWOMKLYKZ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(C(F)(F)F)cn1 |
| Storage condition | -20°C Freezer |
| Stability | Temperature and Moisture Sensitive |
| Hazard Codes | C |
|---|
|
~87%
5-(Trifluoromet... CAS#:174485-72-4 |
| Literature: Latli, Bachir; Hrapchak, Matt; Easter, John A.; Stolle, Wayne T.; Grozinger, Karl; Krishnamurthy, Dhileepkumar; Senanayake, Chris H. Journal of Labelled Compounds and Radiopharmaceuticals, 2008 , vol. 51, # 8 p. 314 - 320 |
|
~%
5-(Trifluoromet... CAS#:174485-72-4 |
| Literature: US6200995 B1, ; |
CAS#:174484-41-4
CAS#:1141510-06-6| 5-(trifluoromethyl)pyridine-2-sulfonyl chloride |
| 5-trifluoromethyl-pyridin-2-ylsulfonylchloride |
| 2-Pyridinesulfonyl chloride, 5-(trifluoromethyl)- |
| RW2855 |
| 5-(Trifluoromethyl)-2-pyridinesulfonyl chloride |
| 5-trifluoromethyl-pyridine-2-sulfonyl chloride |
| 5-trifluoromethyl-2-pyridinylsulfonyl chloride |