2-(Trimethylsilyloxy)ethyl methacrylate structure
|
Common Name | 2-(Trimethylsilyloxy)ethyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 17407-09-9 | Molecular Weight | 202.323 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 215.3±23.0 °C at 760 mmHg | |
| Molecular Formula | C9H18O3Si | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 76.7±0.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(trimethylsiloxy)ethyl methacrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 215.3±23.0 °C at 760 mmHg |
| Molecular Formula | C9H18O3Si |
| Molecular Weight | 202.323 |
| Flash Point | 76.7±0.0 °C |
| Exact Mass | 202.102524 |
| PSA | 35.53000 |
| LogP | 3.06 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.424 |
| InChIKey | WUGOQZFPNUYUOO-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCO[Si](C)(C)C |
| Storage condition | below 5° C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R10;R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| Packaging Group | III |
| HS Code | 2931900090 |
|
~35%
2-(Trimethylsil... CAS#:17407-09-9 |
| Literature: Assadi, Mohammad G.; Mahkam, Mehrdad; Tajrezaiy, Zohreh Journal of Organometallic Chemistry, 2005 , vol. 690, # 21-22 p. 4755 - 4760 |
|
~66%
2-(Trimethylsil... CAS#:17407-09-9 |
| Literature: Boeker, Alexander; Herweg, Thomas; Reihs, Karsten Macromolecules, 2002 , vol. 35, # 13 p. 4929 - 4937 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2-(Trimethylsiloxy)ethyl methacrylate |
| 2-trimethylsilyloxyethyl 2-methylprop-2-enoate |
| 2-(Trimethylsilyloxy)ethyl methacrylate |
| Methacrylic Acid 2-(Trimethylsilyloxy)ethyl Ester |
| EINECS 241-432-1 |
| 2-[(Trimethylsilyl)oxy]ethyl methacrylate |
| 2-((TRIMETHYLSILYL)OXY)ETHYL 2-METHYL-2-PROPENOATE |
| 2-Propenoic acid, 2-methyl-, 2-[(trimethylsilyl)oxy]ethyl ester |
| MFCD00053869 |
| 2-((Trimethylsilyl)oxy)ethyl methacrylate |