1-(2-METHOXY-5-NITROPHENYL)-1H-PYRROLE-2,5-DIONE structure
|
Common Name | 1-(2-METHOXY-5-NITROPHENYL)-1H-PYRROLE-2,5-DIONE | ||
|---|---|---|---|---|
| CAS Number | 17392-67-5 | Molecular Weight | 248.19200 | |
| Density | 1.494g/cm3 | Boiling Point | 450.8ºC at 760mmHg | |
| Molecular Formula | C11H8N2O5 | Melting Point | 158-159ºC | |
| MSDS | N/A | Flash Point | 226.5ºC | |
| Name | 1-(2-methoxy-5-nitrophenyl)pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.494g/cm3 |
|---|---|
| Boiling Point | 450.8ºC at 760mmHg |
| Melting Point | 158-159ºC |
| Molecular Formula | C11H8N2O5 |
| Molecular Weight | 248.19200 |
| Flash Point | 226.5ºC |
| Exact Mass | 248.04300 |
| PSA | 92.43000 |
| LogP | 1.62100 |
| Vapour Pressure | 2.56E-08mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | RQSBMFYAHQPZGS-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])cc1N1C(=O)C=CC1=O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2925190090 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-(5-Nitro-2-methoxy-phenyl)-maleinimid |
| 1-(2-methoxy-5-nitrophenyl)azoline-2,5-dione |
| 1-(2-methoxy-5-nitro-phenyl)-pyrrole-2,5-dione |