3,5-Dinitro-Tyr-OH structure
|
Common Name | 3,5-Dinitro-Tyr-OH | ||
|---|---|---|---|---|
| CAS Number | 17360-11-1 | Molecular Weight | 271.184 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 452.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C9H9N3O7 | Melting Point | 220ºC (dec.)(lit.) | |
| MSDS | N/A | Flash Point | 227.4±28.7 °C | |
| Name | 3,5-dinitro-L-tyrosine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 452.4±45.0 °C at 760 mmHg |
| Melting Point | 220ºC (dec.)(lit.) |
| Molecular Formula | C9H9N3O7 |
| Molecular Weight | 271.184 |
| Flash Point | 227.4±28.7 °C |
| Exact Mass | 271.044037 |
| PSA | 175.19000 |
| LogP | 0.77 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.682 |
| InChIKey | SAZOSDSFLRXREA-YFKPBYRVSA-N |
| SMILES | NC(Cc1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1)C(=O)O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| WGK Germany | 3 |
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00150534 |
| (S)-2-Amino-3-(4-hydroxy-3,5-dinitrophenyl)propanoic acid |
| 3,5-Dinitro-Tyr-OH |
| Tyrosine, 3,5-dinitro- |
| 3,5-Dinitrotyrosine |
| 3,5-Dinitro-l-tyrosine monohydrate |