bis[4-(trifluoromethoxy)phenyl] sulphone structure
|
Common Name | bis[4-(trifluoromethoxy)phenyl] sulphone | ||
|---|---|---|---|---|
| CAS Number | 1735-37-1 | Molecular Weight | 386.26600 | |
| Density | 1.493g/cm3 | Boiling Point | 375.4ºC at 760mmHg | |
| Molecular Formula | C14H8F6O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.9ºC | |
| Name | 1-(trifluoromethoxy)-4-[4-(trifluoromethoxy)phenyl]sulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.493g/cm3 |
|---|---|
| Boiling Point | 375.4ºC at 760mmHg |
| Molecular Formula | C14H8F6O4S |
| Molecular Weight | 386.26600 |
| Flash Point | 180.9ºC |
| Exact Mass | 386.00500 |
| PSA | 60.98000 |
| LogP | 5.39740 |
| Vapour Pressure | 1.68E-05mmHg at 25°C |
| Index of Refraction | 1.482 |
| InChIKey | YNWANXHSJBKIAZ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccc(OC(F)(F)F)cc1)c1ccc(OC(F)(F)F)cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Bis-<4-trifluormethoxy-phenyl>-sulfon |
| EINECS 217-078-9 |