1-[4-(Trifluoromethoxy)phenyl]-2-propanamine hydrochloride (1:1)
Modify Date: 2025-08-25 09:54:57
![1-[4-(Trifluoromethoxy)phenyl]-2-propanamine hydrochloride (1:1) Structure](https://image.chemsrc.com/caspic/024/910408-72-9.png)
1-[4-(Trifluoromethoxy)phenyl]-2-propanamine hydrochloride (1:1) structure
|
Common Name | 1-[4-(Trifluoromethoxy)phenyl]-2-propanamine hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 910408-72-9 | Molecular Weight | 255.66500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[4-(Trifluoromethoxy)phenyl]-2-propanamine hydrochloride (1:1) |
|---|
| Molecular Formula | C10H13ClF3NO |
|---|---|
| Molecular Weight | 255.66500 |
| Exact Mass | 255.06400 |
| PSA | 35.25000 |
| LogP | 3.97720 |
| InChIKey | QCUZYICHYZDNBF-UHFFFAOYSA-N |
| SMILES | CC(N)Cc1ccc(OC(F)(F)F)cc1.Cl |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |