1-propiophenone tosylhydrazone 97 structure
|
Common Name | 1-propiophenone tosylhydrazone 97 | ||
|---|---|---|---|---|
| CAS Number | 17336-66-2 | Molecular Weight | 302.39100 | |
| Density | 1.15g/cm3 | Boiling Point | 448.4ºC at 760 mmHg | |
| Molecular Formula | C16H18N2O2S | Melting Point | 118-120ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 225ºC | |
| Name | Propionophenone p-toluenesulfonylhydrazone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 448.4ºC at 760 mmHg |
| Melting Point | 118-120ºC(lit.) |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.39100 |
| Flash Point | 225ºC |
| Exact Mass | 302.10900 |
| PSA | 66.91000 |
| LogP | 4.55930 |
| Vapour Pressure | 3.1E-08mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | TWTWWQDWKPRWFI-WUKNDPDISA-N |
| SMILES | CCC(=NNS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22;S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2935009090 |
|
~86%
1-propiophenone... CAS#:17336-66-2 |
| Literature: Lambert, Joseph B.; Liu, Xiaoyang Tetrahedron, 1997 , vol. 53, # 29 p. 9989 - 9996 |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 1-PROPIOPHENONE TOSYLHYDRAZONE 97 |
| PROPIOPHENONE (P-TOSYL)HYDRAZONE |
| 1-propiophenone p-toluenesulfonylhydrazone |
| MFCD00159336 |