2-(4-butylanilino)benzoic acid
Modify Date: 2025-08-25 18:01:29
2-(4-butylanilino)benzoic acid structure
|
Common Name | 2-(4-butylanilino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 17332-55-7 | Molecular Weight | 269.33800 | |
| Density | 1.151g/cm3 | Boiling Point | 425.3ºC at 760mmHg | |
| Molecular Formula | C17H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211ºC | |
| Name | 2-(4-butylanilino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.151g/cm3 |
|---|---|
| Boiling Point | 425.3ºC at 760mmHg |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.33800 |
| Flash Point | 211ºC |
| Exact Mass | 269.14200 |
| PSA | 49.33000 |
| LogP | 4.54400 |
| Vapour Pressure | 5.42E-08mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | YUOMTVZNEZTSIA-UHFFFAOYSA-N |
| SMILES | CCCCc1ccc(Nc2ccccc2C(=O)O)cc1 |
|
~%
2-(4-butylanili... CAS#:17332-55-7 |
| Literature: Pinter, Aron; Klussmann, Martin Advanced Synthesis and Catalysis, 2012 , vol. 354, # 4 p. 701 - 711 |
| N-(4'-n-Butylphenyl)anthranilsaeure |
| N-(p-Butylphenyl)anthranilic acid |
| ITF-200 |
| 2-((4-Butylphenyl)amino)benzoic acid |
| 2-(4'-n-butylphenyl)aminobenzoic acid |
| Acido N-(p-n-butilfenil)antranilico |
| Anthranilic acid,N-(p-butylphenyl) |