2-(4-hydroxyphenoxy)benzoic acid structure
|
Common Name | 2-(4-hydroxyphenoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 21905-64-6 | Molecular Weight | 230.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-hydroxyphenoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10O4 |
|---|---|
| Molecular Weight | 230.21600 |
| Exact Mass | 230.05800 |
| PSA | 66.76000 |
| LogP | 2.88270 |
| InChIKey | MEVQXFVFMKKXER-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1Oc1ccc(O)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,o-(p-hydroxyphenoxy) |