2-Chloro-4'-nitroacetanilide structure
|
Common Name | 2-Chloro-4'-nitroacetanilide | ||
|---|---|---|---|---|
| CAS Number | 17329-87-2 | Molecular Weight | 214.60600 | |
| Density | 1.472 g/cm3 | Boiling Point | 439.4ºC at 760 mmHg | |
| Molecular Formula | C8H7ClN2O3 | Melting Point | 185 - 186ºC | |
| MSDS | N/A | Flash Point | 219.6ºC | |
| Name | 2-chloro-N-(4-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.472 g/cm3 |
|---|---|
| Boiling Point | 439.4ºC at 760 mmHg |
| Melting Point | 185 - 186ºC |
| Molecular Formula | C8H7ClN2O3 |
| Molecular Weight | 214.60600 |
| Flash Point | 219.6ºC |
| Exact Mass | 214.01500 |
| PSA | 74.92000 |
| LogP | 2.36830 |
| Vapour Pressure | 6.39E-08mmHg at 25°C |
| Index of Refraction | 1.63 |
| InChIKey | AZURFBCEYQYATI-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1ccc([N+](=O)[O-])cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2924299090 |
|
~94%
2-Chloro-4'-nit... CAS#:17329-87-2 |
| Literature: Jin, Yi; Zhou, Zu-Yu; Tian, Wei; Yu, Qiang; Long, Ya-Qiu Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 22 p. 5864 - 5869 |
|
~%
2-Chloro-4'-nit... CAS#:17329-87-2 |
| Literature: US5807885 A1, ; US 5807885 A |
|
~%
2-Chloro-4'-nit... CAS#:17329-87-2 |
| Literature: Chemische Berichte, , vol. 48, p. 1006 |
|
~%
2-Chloro-4'-nit... CAS#:17329-87-2 |
| Literature: Journal of the American Chemical Society, , vol. 45, p. 1997 |
|
~%
2-Chloro-4'-nit... CAS#:17329-87-2 |
| Literature: Tetrahedron Letters, , vol. 39, # 32 p. 5861 - 5864 |
|
~%
2-Chloro-4'-nit... CAS#:17329-87-2 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , # 4 p. 339 - 344 |
|
~%
2-Chloro-4'-nit... CAS#:17329-87-2 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2>137, p. 161,175 |
|
~%
Detail
|
| Literature: Chemische Berichte, , vol. 48, p. 1006 |
| Precursor 7 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(4-nitrophenyl)-2-chloroacetamide |
| Acetanilide,2-chloro-4'-nitro |
| N1-(4-Nitrophenyl)-2-chloroacetamide |
| 3-chloro-N-(3-nitrophenyl)propanamide |
| p-nitro-N-chloroacetylaniline |
| Acetamide,2-chloro-N-(4-nitrophenyl) |
| 2-Chloro-4'-nitroacetanilide |
| 2-Chloro-N-(4-nitrophenyl)-acetamide |